C30H36 — CID 164832540
2,6,8,12-tetra(propan-2-yl)chrysene (PubChem CID 164832540) has the molecular formula C30H36 and a molecular weight of 396.62 g/mol. Its IUPAC name is 2,6,8,12-tetra(propan-2-yl)chrysene.
| Compound Name | 2,6,8,12-tetra(propan-2-yl)chrysene |
|---|---|
| PubChem CID | 164832540 |
| Molecular Formula | C30H36 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 2,6,8,12-tetra(propan-2-yl)chrysene |
| SMILES | CC(C)c1ccc2c(c1)c(C(C)C)cc1c3ccc(C(C)C)cc3c(C(C)C)cc21 |
| InChI | InChI=1S/C30H36/c1-17(2)21-9-11-23-27(13-21)25(19(5)6)15-30-24-12-10-22(18(3)4)14-28(24)26(20(7)8)16-29(23)30/h9-20H,1-8H3 |
| InChIKey | JDARGBHHCLZCHQ-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|