C16H25Cl — CID 70608971
1-(chloromethyl)-2,3,4-tri(propan-2-yl)benzene (PubChem CID 70608971) has the molecular formula C16H25Cl and a molecular weight of 252.83 g/mol. Its IUPAC name is 1-(chloromethyl)-2,3,4-tri(propan-2-yl)benzene.
| Compound Name | 1-(chloromethyl)-2,3,4-tri(propan-2-yl)benzene |
|---|---|
| PubChem CID | 70608971 |
| Molecular Formula | C16H25Cl |
| Molecular Weight | 252.83 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 1-(chloromethyl)-2,3,4-tri(propan-2-yl)benzene |
| SMILES | CC(C)c1ccc(CCl)c(C(C)C)c1C(C)C |
| InChI | InChI=1S/C16H25Cl/c1-10(2)14-8-7-13(9-17)15(11(3)4)16(14)12(5)6/h7-8,10-12H,9H2,1-6H3 |
| InChIKey | OSMPOLNLDDGOSB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.83 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|