C19H30N2 — CID 88599363
N'-propan-2-yl-N-[2,3,4-tri(propan-2-yl)phenyl]methanediimine (PubChem CID 88599363) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is N'-propan-2-yl-N-[2,3,4-tri(propan-2-yl)phenyl]methanediimine.
| Compound Name | N'-propan-2-yl-N-[2,3,4-tri(propan-2-yl)phenyl]methanediimine |
|---|---|
| PubChem CID | 88599363 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | N'-propan-2-yl-N-[2,3,4-tri(propan-2-yl)phenyl]methanediimine |
| SMILES | CC(C)N=C=Nc1ccc(C(C)C)c(C(C)C)c1C(C)C |
| InChI | InChI=1S/C19H30N2/c1-12(2)16-9-10-17(21-11-20-15(7)8)19(14(5)6)18(16)13(3)4/h9-10,12-15H,1-8H3 |
| InChIKey | KOWCRZFVEDEVCR-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|