About N,N'-di(propan-2-yl)methanediimine;hydrobromide
N,N'-di(propan-2-yl)methanediimine;hydrobromide (PubChem CID 88647756) has the molecular formula C7H15BrN2
and a molecular weight of 207.11 g/mol. Its IUPAC name is N,N'-di(propan-2-yl)methanediimine;hydrobromide.
Molecular Properties
| Compound Name | N,N'-di(propan-2-yl)methanediimine;hydrobromide |
| PubChem CID | 88647756 |
| Molecular Formula | C7H15BrN2 |
| Molecular Weight | 207.11 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | N,N'-di(propan-2-yl)methanediimine;hydrobromide |
| SMILES | Br.CC(C)N=C=NC(C)C |
| InChI | InChI=1S/C7H14N2.BrH/c1-6(2)8-5-9-7(3)4;/h6-7H,1-4H3;1H |
| InChIKey | WKUNGLWJQBOBJG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.11 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N'-di(propan-2-yl)methanediimine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-di(propan-2-yl)methanediimine;hydrobromide?
The IUPAC name of N,N'-di(propan-2-yl)methanediimine;hydrobromide (CID 88647756) is N,N'-di(propan-2-yl)methanediimine;hydrobromide.
What is the SMILES notation for N,N'-di(propan-2-yl)methanediimine;hydrobromide?
The canonical SMILES for N,N'-di(propan-2-yl)methanediimine;hydrobromide is Br.CC(C)N=C=NC(C)C.
What is the InChIKey of N,N'-di(propan-2-yl)methanediimine;hydrobromide?
The InChIKey is WKUNGLWJQBOBJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.BrH/c1-6(2)8-5-9-7(3)4;/h6-7H,1-4H3;1H.
What are the key properties of N,N'-di(propan-2-yl)methanediimine;hydrobromide?
N,N'-di(propan-2-yl)methanediimine;hydrobromide has a molecular weight of 207.11 g/mol, XLogP of 2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-di(propan-2-yl)methanediimine;hydrobromide is sourced from PubChem (CID 88647756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).