C7H15BrN2 — CID 88647756
N,N'-di(propan-2-yl)methanediimine;hydrobromide (PubChem CID 88647756) has the molecular formula C7H15BrN2 and a molecular weight of 207.11 g/mol. Its IUPAC name is N,N'-di(propan-2-yl)methanediimine;hydrobromide.
| Compound Name | N,N'-di(propan-2-yl)methanediimine;hydrobromide |
|---|---|
| PubChem CID | 88647756 |
| Molecular Formula | C7H15BrN2 |
| Molecular Weight | 207.11 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | N,N'-di(propan-2-yl)methanediimine;hydrobromide |
| SMILES | Br.CC(C)N=C=NC(C)C |
| InChI | InChI=1S/C7H14N2.BrH/c1-6(2)8-5-9-7(3)4;/h6-7H,1-4H3;1H |
| InChIKey | WKUNGLWJQBOBJG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.11 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|