About CID 5462981
CID 5462981 (PubChem CID 5462981) has the molecular formula C6H14N
and a molecular weight of 100.18 g/mol.
Molecular Properties
| Compound Name | CID 5462981 |
| PubChem CID | 5462981 |
| Molecular Formula | C6H14N |
| Molecular Weight | 100.18 g/mol |
| Exact Mass | 100.11 |
| IUPAC Name | — |
| SMILES | CC(C)[N]C(C)C |
| InChI | InChI=1S/C6H14N/c1-5(2)7-6(3)4/h5-6H,1-4H3 |
| InChIKey | NWMDMRWOXWXQEY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 5462981 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 5462981?
The IUPAC name of CID 5462981 (CID 5462981) is not available.
What is the SMILES notation for CID 5462981?
The canonical SMILES for CID 5462981 is CC(C)[N]C(C)C.
What is the InChIKey of CID 5462981?
The InChIKey is NWMDMRWOXWXQEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N/c1-5(2)7-6(3)4/h5-6H,1-4H3.
What are the key properties of CID 5462981?
CID 5462981 has a molecular weight of 100.18 g/mol, XLogP of 1.41, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 5462981 is sourced from PubChem (CID 5462981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).