About bis(N,N'-di(propan-2-yl)ethane-1,2-diimine);titanium
bis(N,N'-di(propan-2-yl)ethane-1,2-diimine);titanium (PubChem CID 159257607) has the molecular formula C16H32N4Ti
and a molecular weight of 328.33 g/mol. Its IUPAC name is bis(N,N'-di(propan-2-yl)ethane-1,2-diimine);titanium.
Molecular Properties
| Compound Name | bis(N,N'-di(propan-2-yl)ethane-1,2-diimine);titanium |
| PubChem CID | 159257607 |
| Molecular Formula | C16H32N4Ti |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | bis(N,N'-di(propan-2-yl)ethane-1,2-diimine);titanium |
| SMILES | CC(C)/N=C/C=N/C(C)C.CC(C)/N=C/C=N/C(C)C.[Ti] |
| InChI | InChI=1S/2C8H16N2.Ti/c2*1-7(2)9-5-6-10-8(3)4;/h2*5-8H,1-4H3;/b2*9-5+,10-6+; |
| InChIKey | KWCDABWZNXRBBA-RAUUXQRVSA-N |
| XLogP | 3.89 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze bis(N,N'-di(propan-2-yl)ethane-1,2-diimine);titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N,N'-di(propan-2-yl)ethane-1,2-diimine);titanium?
The IUPAC name of bis(N,N'-di(propan-2-yl)ethane-1,2-diimine);titanium (CID 159257607) is bis(N,N'-di(propan-2-yl)ethane-1,2-diimine);titanium.
What is the SMILES notation for bis(N,N'-di(propan-2-yl)ethane-1,2-diimine);titanium?
The canonical SMILES for bis(N,N'-di(propan-2-yl)ethane-1,2-diimine);titanium is CC(C)/N=C/C=N/C(C)C.CC(C)/N=C/C=N/C(C)C.[Ti].
What is the InChIKey of bis(N,N'-di(propan-2-yl)ethane-1,2-diimine);titanium?
The InChIKey is KWCDABWZNXRBBA-RAUUXQRVSA-N. The full InChI is InChI=1S/2C8H16N2.Ti/c2*1-7(2)9-5-6-10-8(3)4;/h2*5-8H,1-4H3;/b2*9-5+,10-6+;.
What are the key properties of bis(N,N'-di(propan-2-yl)ethane-1,2-diimine);titanium?
bis(N,N'-di(propan-2-yl)ethane-1,2-diimine);titanium has a molecular weight of 328.33 g/mol, XLogP of 3.89, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N,N'-di(propan-2-yl)ethane-1,2-diimine);titanium is sourced from PubChem (CID 159257607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).