C16H32N4Ti — CID 159257607
bis(N,N'-di(propan-2-yl)ethane-1,2-diimine);titanium (PubChem CID 159257607) has the molecular formula C16H32N4Ti and a molecular weight of 328.33 g/mol. Its IUPAC name is bis(N,N'-di(propan-2-yl)ethane-1,2-diimine);titanium.
| Compound Name | bis(N,N'-di(propan-2-yl)ethane-1,2-diimine);titanium |
|---|---|
| PubChem CID | 159257607 |
| Molecular Formula | C16H32N4Ti |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | bis(N,N'-di(propan-2-yl)ethane-1,2-diimine);titanium |
| SMILES | CC(C)/N=C/C=N/C(C)C.CC(C)/N=C/C=N/C(C)C.[Ti] |
| InChI | InChI=1S/2C8H16N2.Ti/c2*1-7(2)9-5-6-10-8(3)4;/h2*5-8H,1-4H3;/b2*9-5+,10-6+; |
| InChIKey | KWCDABWZNXRBBA-RAUUXQRVSA-N |
| XLogP | 3.89 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|