C14H28N2 — CID 102501008
N,N'-bis[(2S)-3,3-dimethylbutan-2-yl]ethane-1,2-diimine (PubChem CID 102501008) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is N,N'-bis[(2S)-3,3-dimethylbutan-2-yl]ethane-1,2-diimine.
| Compound Name | N,N'-bis[(2S)-3,3-dimethylbutan-2-yl]ethane-1,2-diimine |
|---|---|
| PubChem CID | 102501008 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | N,N'-bis[(2S)-3,3-dimethylbutan-2-yl]ethane-1,2-diimine |
| SMILES | C[C@H](/N=C/C=N/[C@@H](C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H28N2/c1-11(13(3,4)5)15-9-10-16-12(2)14(6,7)8/h9-12H,1-8H3/b15-9+,16-10+/t11-,12-/m0/s1 |
| InChIKey | VHRHMJDXFLKJGZ-ZMQQEENBSA-N |
| XLogP | 4.00 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|