C11H24N2 — CID 104830077
N'-(3,3-dimethylbutan-2-yl)-2,2-dimethylpropanimidamide (PubChem CID 104830077) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is N'-(3,3-dimethylbutan-2-yl)-2,2-dimethylpropanimidamide.
| Compound Name | N'-(3,3-dimethylbutan-2-yl)-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 104830077 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | N'-(3,3-dimethylbutan-2-yl)-2,2-dimethylpropanimidamide |
| SMILES | CC(/N=C(\N)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H24N2/c1-8(10(2,3)4)13-9(12)11(5,6)7/h8H,1-7H3,(H2,12,13) |
| InChIKey | ZNMGTPXHLZAGKR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|