About N'-(3,3-dimethylbutan-2-yl)-2,2-dimethylpropanimidamide
N'-(3,3-dimethylbutan-2-yl)-2,2-dimethylpropanimidamide (PubChem CID 104830077) has the molecular formula C11H24N2
and a molecular weight of 184.33 g/mol. Its IUPAC name is N'-(3,3-dimethylbutan-2-yl)-2,2-dimethylpropanimidamide.
Molecular Properties
| Compound Name | N'-(3,3-dimethylbutan-2-yl)-2,2-dimethylpropanimidamide |
| PubChem CID | 104830077 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | N'-(3,3-dimethylbutan-2-yl)-2,2-dimethylpropanimidamide |
| SMILES | CC(/N=C(\N)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H24N2/c1-8(10(2,3)4)13-9(12)11(5,6)7/h8H,1-7H3,(H2,12,13) |
| InChIKey | ZNMGTPXHLZAGKR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(3,3-dimethylbutan-2-yl)-2,2-dimethylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3,3-dimethylbutan-2-yl)-2,2-dimethylpropanimidamide?
The IUPAC name of N'-(3,3-dimethylbutan-2-yl)-2,2-dimethylpropanimidamide (CID 104830077) is N'-(3,3-dimethylbutan-2-yl)-2,2-dimethylpropanimidamide.
What is the SMILES notation for N'-(3,3-dimethylbutan-2-yl)-2,2-dimethylpropanimidamide?
The canonical SMILES for N'-(3,3-dimethylbutan-2-yl)-2,2-dimethylpropanimidamide is CC(/N=C(\N)C(C)(C)C)C(C)(C)C.
What is the InChIKey of N'-(3,3-dimethylbutan-2-yl)-2,2-dimethylpropanimidamide?
The InChIKey is ZNMGTPXHLZAGKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2/c1-8(10(2,3)4)13-9(12)11(5,6)7/h8H,1-7H3,(H2,12,13).
What are the key properties of N'-(3,3-dimethylbutan-2-yl)-2,2-dimethylpropanimidamide?
N'-(3,3-dimethylbutan-2-yl)-2,2-dimethylpropanimidamide has a molecular weight of 184.33 g/mol, XLogP of 2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3,3-dimethylbutan-2-yl)-2,2-dimethylpropanimidamide is sourced from PubChem (CID 104830077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).