C12H26N2 — CID 63924978
2,2-dimethyl-N'-(5-methylhexan-2-yl)propanimidamide (PubChem CID 63924978) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is 2,2-dimethyl-N'-(5-methylhexan-2-yl)propanimidamide.
| Compound Name | 2,2-dimethyl-N'-(5-methylhexan-2-yl)propanimidamide |
|---|---|
| PubChem CID | 63924978 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 2,2-dimethyl-N'-(5-methylhexan-2-yl)propanimidamide |
| SMILES | CC(C)CCC(C)/N=C(\N)C(C)(C)C |
| InChI | InChI=1S/C12H26N2/c1-9(2)7-8-10(3)14-11(13)12(4,5)6/h9-10H,7-8H2,1-6H3,(H2,13,14) |
| InChIKey | SVDSBNMCSVFNBJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|