C10H22N2O — CID 116732354
2-methoxy-3,3-dimethyl-N'-propan-2-ylbutanimidamide (PubChem CID 116732354) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 2-methoxy-3,3-dimethyl-N'-propan-2-ylbutanimidamide.
| Compound Name | 2-methoxy-3,3-dimethyl-N'-propan-2-ylbutanimidamide |
|---|---|
| PubChem CID | 116732354 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 2-methoxy-3,3-dimethyl-N'-propan-2-ylbutanimidamide |
| SMILES | COC(/C(N)=N/C(C)C)C(C)(C)C |
| InChI | InChI=1S/C10H22N2O/c1-7(2)12-9(11)8(13-6)10(3,4)5/h7-8H,1-6H3,(H2,11,12) |
| InChIKey | CJXBCTGIUROPTB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|