About 2-ethoxy-3-methyl-N'-propan-2-ylbutanimidamide
2-ethoxy-3-methyl-N'-propan-2-ylbutanimidamide (PubChem CID 116732358) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is 2-ethoxy-3-methyl-N'-propan-2-ylbutanimidamide.
Molecular Properties
| Compound Name | 2-ethoxy-3-methyl-N'-propan-2-ylbutanimidamide |
| PubChem CID | 116732358 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 2-ethoxy-3-methyl-N'-propan-2-ylbutanimidamide |
| SMILES | CCOC(/C(N)=N/C(C)C)C(C)C |
| InChI | InChI=1S/C10H22N2O/c1-6-13-9(7(2)3)10(11)12-8(4)5/h7-9H,6H2,1-5H3,(H2,11,12) |
| InChIKey | NZGMIJXYUUZNQZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-3-methyl-N'-propan-2-ylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-3-methyl-N'-propan-2-ylbutanimidamide?
The IUPAC name of 2-ethoxy-3-methyl-N'-propan-2-ylbutanimidamide (CID 116732358) is 2-ethoxy-3-methyl-N'-propan-2-ylbutanimidamide.
What is the SMILES notation for 2-ethoxy-3-methyl-N'-propan-2-ylbutanimidamide?
The canonical SMILES for 2-ethoxy-3-methyl-N'-propan-2-ylbutanimidamide is CCOC(/C(N)=N/C(C)C)C(C)C.
What is the InChIKey of 2-ethoxy-3-methyl-N'-propan-2-ylbutanimidamide?
The InChIKey is NZGMIJXYUUZNQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-6-13-9(7(2)3)10(11)12-8(4)5/h7-9H,6H2,1-5H3,(H2,11,12).
What are the key properties of 2-ethoxy-3-methyl-N'-propan-2-ylbutanimidamide?
2-ethoxy-3-methyl-N'-propan-2-ylbutanimidamide has a molecular weight of 186.30 g/mol, XLogP of 1.81, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3-methyl-N'-propan-2-ylbutanimidamide is sourced from PubChem (CID 116732358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).