About N'-(1-methoxyethyl)-N-methylethane-1,2-diimine
N'-(1-methoxyethyl)-N-methylethane-1,2-diimine (PubChem CID 163808550) has the molecular formula C6H12N2O
and a molecular weight of 128.17 g/mol. Its IUPAC name is N'-(1-methoxyethyl)-N-methylethane-1,2-diimine.
Molecular Properties
| Compound Name | N'-(1-methoxyethyl)-N-methylethane-1,2-diimine |
| PubChem CID | 163808550 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | N'-(1-methoxyethyl)-N-methylethane-1,2-diimine |
| SMILES | C/N=C/C=NC(C)OC |
| InChI | InChI=1S/C6H12N2O/c1-6(9-3)8-5-4-7-2/h4-6H,1-3H3/b7-4+,8-5? |
| InChIKey | NLFRANVVFHFDOR-KPFNVLSRSA-N |
| XLogP | 0.75 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N'-(1-methoxyethyl)-N-methylethane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-methoxyethyl)-N-methylethane-1,2-diimine?
The IUPAC name of N'-(1-methoxyethyl)-N-methylethane-1,2-diimine (CID 163808550) is N'-(1-methoxyethyl)-N-methylethane-1,2-diimine.
What is the SMILES notation for N'-(1-methoxyethyl)-N-methylethane-1,2-diimine?
The canonical SMILES for N'-(1-methoxyethyl)-N-methylethane-1,2-diimine is C/N=C/C=NC(C)OC.
What is the InChIKey of N'-(1-methoxyethyl)-N-methylethane-1,2-diimine?
The InChIKey is NLFRANVVFHFDOR-KPFNVLSRSA-N. The full InChI is InChI=1S/C6H12N2O/c1-6(9-3)8-5-4-7-2/h4-6H,1-3H3/b7-4+,8-5?.
What are the key properties of N'-(1-methoxyethyl)-N-methylethane-1,2-diimine?
N'-(1-methoxyethyl)-N-methylethane-1,2-diimine has a molecular weight of 128.17 g/mol, XLogP of 0.75, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-methoxyethyl)-N-methylethane-1,2-diimine is sourced from PubChem (CID 163808550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).