C6H12N2O — CID 163808550
N'-(1-methoxyethyl)-N-methylethane-1,2-diimine (PubChem CID 163808550) has the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is N'-(1-methoxyethyl)-N-methylethane-1,2-diimine.
| Compound Name | N'-(1-methoxyethyl)-N-methylethane-1,2-diimine |
|---|---|
| PubChem CID | 163808550 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | N'-(1-methoxyethyl)-N-methylethane-1,2-diimine |
| SMILES | C/N=C/C=NC(C)OC |
| InChI | InChI=1S/C6H12N2O/c1-6(9-3)8-5-4-7-2/h4-6H,1-3H3/b7-4+,8-5? |
| InChIKey | NLFRANVVFHFDOR-KPFNVLSRSA-N |
| XLogP | 0.75 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|