C16H32N2 — CID 610573
N,N'-bis(2,4-dimethylpentan-3-yl)ethane-1,2-diimine (PubChem CID 610573) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is N,N'-bis(2,4-dimethylpentan-3-yl)ethane-1,2-diimine.
| Compound Name | N,N'-bis(2,4-dimethylpentan-3-yl)ethane-1,2-diimine |
|---|---|
| PubChem CID | 610573 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | N,N'-bis(2,4-dimethylpentan-3-yl)ethane-1,2-diimine |
| SMILES | CC(C)C(/N=C/C=N/C(C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C16H32N2/c1-11(2)15(12(3)4)17-9-10-18-16(13(5)6)14(7)8/h9-16H,1-8H3/b17-9+,18-10+ |
| InChIKey | OPLJRHRBQBCCER-BEQMOXJMSA-N |
| XLogP | 4.49 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|