C8H14F3N — CID 102263378
N-[(2R)-3,3-dimethylbutan-2-yl]-2,2,2-trifluoroethanimine (PubChem CID 102263378) has the molecular formula C8H14F3N and a molecular weight of 181.20 g/mol. Its IUPAC name is N-[(2R)-3,3-dimethylbutan-2-yl]-2,2,2-trifluoroethanimine.
| Compound Name | N-[(2R)-3,3-dimethylbutan-2-yl]-2,2,2-trifluoroethanimine |
|---|---|
| PubChem CID | 102263378 |
| Molecular Formula | C8H14F3N |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | N-[(2R)-3,3-dimethylbutan-2-yl]-2,2,2-trifluoroethanimine |
| SMILES | C[C@@H](/N=C/C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C8H14F3N/c1-6(7(2,3)4)12-5-8(9,10)11/h5-6H,1-4H3/b12-5+/t6-/m1/s1 |
| InChIKey | QHCYQPNFFINBEY-HDDZKMFUSA-N |
| XLogP | 3.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|