C14H28F3NOSi — CID 11536901
2,2,2-trifluoro-N-[(2S)-4-methyl-1-triethylsilyloxypentan-2-yl]ethanimine (PubChem CID 11536901) has the molecular formula C14H28F3NOSi and a molecular weight of 311.46 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2S)-4-methyl-1-triethylsilyloxypentan-2-yl]ethanimine.
| Compound Name | 2,2,2-trifluoro-N-[(2S)-4-methyl-1-triethylsilyloxypentan-2-yl]ethanimine |
|---|---|
| PubChem CID | 11536901 |
| Molecular Formula | C14H28F3NOSi |
| Molecular Weight | 311.46 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2S)-4-methyl-1-triethylsilyloxypentan-2-yl]ethanimine |
| SMILES | CC[Si](CC)(CC)OC[C@H](CC(C)C)/N=C/C(F)(F)F |
| InChI | InChI=1S/C14H28F3NOSi/c1-6-20(7-2,8-3)19-10-13(9-12(4)5)18-11-14(15,16)17/h11-13H,6-10H2,1-5H3/b18-11+/t13-/m0/s1 |
| InChIKey | GGEUMBQIDNTYHQ-FHXOWUIVSA-N |
| XLogP | 5.06 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|