C16H34O2Si — CID 134945880
(E,2R,3S)-2-methyl-1-triethylsilyloxynon-4-en-3-ol (PubChem CID 134945880) has the molecular formula C16H34O2Si and a molecular weight of 286.53 g/mol. Its IUPAC name is (E,2R,3S)-2-methyl-1-triethylsilyloxynon-4-en-3-ol.
| Compound Name | (E,2R,3S)-2-methyl-1-triethylsilyloxynon-4-en-3-ol |
|---|---|
| PubChem CID | 134945880 |
| Molecular Formula | C16H34O2Si |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (E,2R,3S)-2-methyl-1-triethylsilyloxynon-4-en-3-ol |
| SMILES | CCCC/C=C/[C@H](O)[C@H](C)CO[Si](CC)(CC)CC |
| InChI | InChI=1S/C16H34O2Si/c1-6-10-11-12-13-16(17)15(5)14-18-19(7-2,8-3)9-4/h12-13,15-17H,6-11,14H2,1-5H3/b13-12+/t15-,16+/m1/s1 |
| InChIKey | SPLOALOMWSHUID-DGLSUBJASA-N |
| XLogP | 4.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|