C5H7F3N2O — CID 162564917
(2S)-2-amino-N-(2,2,2-trifluoroethylidene)propanamide (PubChem CID 162564917) has the molecular formula C5H7F3N2O and a molecular weight of 168.12 g/mol. Its IUPAC name is (2S)-2-amino-N-(2,2,2-trifluoroethylidene)propanamide.
| Compound Name | (2S)-2-amino-N-(2,2,2-trifluoroethylidene)propanamide |
|---|---|
| PubChem CID | 162564917 |
| Molecular Formula | C5H7F3N2O |
| Molecular Weight | 168.12 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | (2S)-2-amino-N-(2,2,2-trifluoroethylidene)propanamide |
| SMILES | C[C@H](N)C(=O)/N=C/C(F)(F)F |
| InChI | InChI=1S/C5H7F3N2O/c1-3(9)4(11)10-2-5(6,7)8/h2-3H,9H2,1H3/b10-2+/t3-/m0/s1 |
| InChIKey | NPJGEOVDWAQVGW-IZHDJAMQSA-N |
| XLogP | 0.49 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.12 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|