C10H22F3NO — CID 171530254
3,3-dimethylbutan-2-amine;ethane;2,2,2-trifluoroacetaldehyde (PubChem CID 171530254) has the molecular formula C10H22F3NO and a molecular weight of 229.29 g/mol. Its IUPAC name is 3,3-dimethylbutan-2-amine;ethane;2,2,2-trifluoroacetaldehyde.
| Compound Name | 3,3-dimethylbutan-2-amine;ethane;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 171530254 |
| Molecular Formula | C10H22F3NO |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 3,3-dimethylbutan-2-amine;ethane;2,2,2-trifluoroacetaldehyde |
| SMILES | CC.CC(N)C(C)(C)C.O=CC(F)(F)F |
| InChI | InChI=1S/C6H15N.C2HF3O.C2H6/c1-5(7)6(2,3)4;3-2(4,5)1-6;1-2/h5H,7H2,1-4H3;1H;1-2H3 |
| InChIKey | NQZADFPEOGQEFD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|