About N-[(2S)-1-methoxypropan-2-yl]-2,2-dimethylpropan-1-imine
N-[(2S)-1-methoxypropan-2-yl]-2,2-dimethylpropan-1-imine (PubChem CID 10888172) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is N-[(2S)-1-methoxypropan-2-yl]-2,2-dimethylpropan-1-imine.
Molecular Properties
| Compound Name | N-[(2S)-1-methoxypropan-2-yl]-2,2-dimethylpropan-1-imine |
| PubChem CID | 10888172 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | N-[(2S)-1-methoxypropan-2-yl]-2,2-dimethylpropan-1-imine |
| SMILES | COC[C@H](C)/N=C/C(C)(C)C |
| InChI | InChI=1S/C9H19NO/c1-8(6-11-5)10-7-9(2,3)4/h7-8H,6H2,1-5H3/b10-7+/t8-/m0/s1 |
| InChIKey | PHICAQZHCLLARQ-VKHJRQFRSA-N |
| XLogP | 2.14 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S)-1-methoxypropan-2-yl]-2,2-dimethylpropan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-1-methoxypropan-2-yl]-2,2-dimethylpropan-1-imine?
The IUPAC name of N-[(2S)-1-methoxypropan-2-yl]-2,2-dimethylpropan-1-imine (CID 10888172) is N-[(2S)-1-methoxypropan-2-yl]-2,2-dimethylpropan-1-imine.
What is the SMILES notation for N-[(2S)-1-methoxypropan-2-yl]-2,2-dimethylpropan-1-imine?
The canonical SMILES for N-[(2S)-1-methoxypropan-2-yl]-2,2-dimethylpropan-1-imine is COC[C@H](C)/N=C/C(C)(C)C.
What is the InChIKey of N-[(2S)-1-methoxypropan-2-yl]-2,2-dimethylpropan-1-imine?
The InChIKey is PHICAQZHCLLARQ-VKHJRQFRSA-N. The full InChI is InChI=1S/C9H19NO/c1-8(6-11-5)10-7-9(2,3)4/h7-8H,6H2,1-5H3/b10-7+/t8-/m0/s1.
What are the key properties of N-[(2S)-1-methoxypropan-2-yl]-2,2-dimethylpropan-1-imine?
N-[(2S)-1-methoxypropan-2-yl]-2,2-dimethylpropan-1-imine has a molecular weight of 157.26 g/mol, XLogP of 2.14, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-1-methoxypropan-2-yl]-2,2-dimethylpropan-1-imine is sourced from PubChem (CID 10888172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).