C15H34O4 — CID 162031327
2,2-dimethoxypropane;2-methyl-1-[2-(2-methylpropoxy)ethoxy]propane (PubChem CID 162031327) has the molecular formula C15H34O4 and a molecular weight of 278.43 g/mol. Its IUPAC name is 2,2-dimethoxypropane;2-methyl-1-[2-(2-methylpropoxy)ethoxy]propane.
| Compound Name | 2,2-dimethoxypropane;2-methyl-1-[2-(2-methylpropoxy)ethoxy]propane |
|---|---|
| PubChem CID | 162031327 |
| Molecular Formula | C15H34O4 |
| Molecular Weight | 278.43 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | 2,2-dimethoxypropane;2-methyl-1-[2-(2-methylpropoxy)ethoxy]propane |
| SMILES | CC(C)COCCOCC(C)C.COC(C)(C)OC |
| InChI | InChI=1S/C10H22O2.C5H12O2/c1-9(2)7-11-5-6-12-8-10(3)4;1-5(2,6-3)7-4/h9-10H,5-8H2,1-4H3;1-4H3 |
| InChIKey | YWBFSDIAAMXVSY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|