C8H14F3N3O — CID 169213418
(E)-4,4,4-trifluoro-3-(1-methoxypropan-2-ylimino)but-1-ene-1,2-diamine (PubChem CID 169213418) has the molecular formula C8H14F3N3O and a molecular weight of 225.21 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-3-(1-methoxypropan-2-ylimino)but-1-ene-1,2-diamine.
| Compound Name | (E)-4,4,4-trifluoro-3-(1-methoxypropan-2-ylimino)but-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 169213418 |
| Molecular Formula | C8H14F3N3O |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | (E)-4,4,4-trifluoro-3-(1-methoxypropan-2-ylimino)but-1-ene-1,2-diamine |
| SMILES | COCC(C)/N=C(C(/N)=C\N)\C(F)(F)F |
| InChI | InChI=1S/C8H14F3N3O/c1-5(4-15-2)14-7(6(13)3-12)8(9,10)11/h3,5H,4,12-13H2,1-2H3/b6-3+,14-7- |
| InChIKey | PXRMRPJVBIYMKI-PJTBNZIESA-N |
| XLogP | 0.78 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|