C11H17F3N2O3 — CID 174139166
ethyl 2-(aminomethylidene)-4,4,4-trifluoro-3-(1-methoxypropan-2-ylimino)butanoate (PubChem CID 174139166) has the molecular formula C11H17F3N2O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is ethyl 2-(aminomethylidene)-4,4,4-trifluoro-3-(1-methoxypropan-2-ylimino)butanoate.
| Compound Name | ethyl 2-(aminomethylidene)-4,4,4-trifluoro-3-(1-methoxypropan-2-ylimino)butanoate |
|---|---|
| PubChem CID | 174139166 |
| Molecular Formula | C11H17F3N2O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | ethyl 2-(aminomethylidene)-4,4,4-trifluoro-3-(1-methoxypropan-2-ylimino)butanoate |
| SMILES | CCOC(=O)C(=CN)/C(=N/C(C)COC)C(F)(F)F |
| InChI | InChI=1S/C11H17F3N2O3/c1-4-19-10(17)8(5-15)9(11(12,13)14)16-7(2)6-18-3/h5,7H,4,6,15H2,1-3H3/b8-5?,16-9- |
| InChIKey | SWHMLGREKHVQKM-JSOUMPFSSA-N |
| XLogP | 1.43 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|