About methane;N-propan-2-ylethanimine
methane;N-propan-2-ylethanimine (PubChem CID 159100723) has the molecular formula C6H15N
and a molecular weight of 101.19 g/mol. Its IUPAC name is methane;N-propan-2-ylethanimine.
Molecular Properties
| Compound Name | methane;N-propan-2-ylethanimine |
| PubChem CID | 159100723 |
| Molecular Formula | C6H15N |
| Molecular Weight | 101.19 g/mol |
| Exact Mass | 101.12 |
| IUPAC Name | methane;N-propan-2-ylethanimine |
| SMILES | C.C/C=N/C(C)C |
| InChI | InChI=1S/C5H11N.CH4/c1-4-6-5(2)3;/h4-5H,1-3H3;1H4/b6-4+; |
| InChIKey | KDFXNPSDTQCKHC-CVDVRWGVSA-N |
| XLogP | 2.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.19 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methane;N-propan-2-ylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;N-propan-2-ylethanimine?
The IUPAC name of methane;N-propan-2-ylethanimine (CID 159100723) is methane;N-propan-2-ylethanimine.
What is the SMILES notation for methane;N-propan-2-ylethanimine?
The canonical SMILES for methane;N-propan-2-ylethanimine is C.C/C=N/C(C)C.
What is the InChIKey of methane;N-propan-2-ylethanimine?
The InChIKey is KDFXNPSDTQCKHC-CVDVRWGVSA-N. The full InChI is InChI=1S/C5H11N.CH4/c1-4-6-5(2)3;/h4-5H,1-3H3;1H4/b6-4+;.
What are the key properties of methane;N-propan-2-ylethanimine?
methane;N-propan-2-ylethanimine has a molecular weight of 101.19 g/mol, XLogP of 2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;N-propan-2-ylethanimine is sourced from PubChem (CID 159100723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).