About bis(propan-2-ylimino)molybdenum(2+);bis(dimethylazanide)
bis(propan-2-ylimino)molybdenum(2+);bis(dimethylazanide) (PubChem CID 169227251) has the molecular formula C10H26MoN4
and a molecular weight of 298.29 g/mol. Its IUPAC name is bis(propan-2-ylimino)molybdenum(2+);bis(dimethylazanide).
Molecular Properties
| Compound Name | bis(propan-2-ylimino)molybdenum(2+);bis(dimethylazanide) |
| PubChem CID | 169227251 |
| Molecular Formula | C10H26MoN4 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | bis(propan-2-ylimino)molybdenum(2+);bis(dimethylazanide) |
| SMILES | CC(C)N=[Mo+2]=NC(C)C.C[N-]C.C[N-]C |
| InChI | InChI=1S/2C3H7N.2C2H6N.Mo/c2*1-3(2)4;2*1-3-2;/h2*3H,1-2H3;2*1-2H3;/q;;2*-1;+2 |
| InChIKey | KUCLSWJVLXZNEM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(propan-2-ylimino)molybdenum(2+);bis(dimethylazanide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(propan-2-ylimino)molybdenum(2+);bis(dimethylazanide)?
The IUPAC name of bis(propan-2-ylimino)molybdenum(2+);bis(dimethylazanide) (CID 169227251) is bis(propan-2-ylimino)molybdenum(2+);bis(dimethylazanide).
What is the SMILES notation for bis(propan-2-ylimino)molybdenum(2+);bis(dimethylazanide)?
The canonical SMILES for bis(propan-2-ylimino)molybdenum(2+);bis(dimethylazanide) is CC(C)N=[Mo+2]=NC(C)C.C[N-]C.C[N-]C.
What is the InChIKey of bis(propan-2-ylimino)molybdenum(2+);bis(dimethylazanide)?
The InChIKey is KUCLSWJVLXZNEM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H7N.2C2H6N.Mo/c2*1-3(2)4;2*1-3-2;/h2*3H,1-2H3;2*1-2H3;/q;;2*-1;+2.
What are the key properties of bis(propan-2-ylimino)molybdenum(2+);bis(dimethylazanide)?
bis(propan-2-ylimino)molybdenum(2+);bis(dimethylazanide) has a molecular weight of 298.29 g/mol, XLogP of 3.49, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(propan-2-ylimino)molybdenum(2+);bis(dimethylazanide) is sourced from PubChem (CID 169227251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).