About bis(di(propan-2-yl)azanide);molybdenum(2+)
bis(di(propan-2-yl)azanide);molybdenum(2+) (PubChem CID 141200548) has the molecular formula C12H28MoN2
and a molecular weight of 296.31 g/mol. Its IUPAC name is bis(di(propan-2-yl)azanide);molybdenum(2+).
Molecular Properties
| Compound Name | bis(di(propan-2-yl)azanide);molybdenum(2+) |
| PubChem CID | 141200548 |
| Molecular Formula | C12H28MoN2 |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | bis(di(propan-2-yl)azanide);molybdenum(2+) |
| SMILES | CC(C)[N-]C(C)C.CC(C)[N-]C(C)C.[Mo+2] |
| InChI | InChI=1S/2C6H14N.Mo/c2*1-5(2)7-6(3)4;/h2*5-6H,1-4H3;/q2*-1;+2 |
| InChIKey | INKHBZSBHWRYGP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bis(di(propan-2-yl)azanide);molybdenum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(di(propan-2-yl)azanide);molybdenum(2+)?
The IUPAC name of bis(di(propan-2-yl)azanide);molybdenum(2+) (CID 141200548) is bis(di(propan-2-yl)azanide);molybdenum(2+).
What is the SMILES notation for bis(di(propan-2-yl)azanide);molybdenum(2+)?
The canonical SMILES for bis(di(propan-2-yl)azanide);molybdenum(2+) is CC(C)[N-]C(C)C.CC(C)[N-]C(C)C.[Mo+2].
What is the InChIKey of bis(di(propan-2-yl)azanide);molybdenum(2+)?
The InChIKey is INKHBZSBHWRYGP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H14N.Mo/c2*1-5(2)7-6(3)4;/h2*5-6H,1-4H3;/q2*-1;+2.
What are the key properties of bis(di(propan-2-yl)azanide);molybdenum(2+)?
bis(di(propan-2-yl)azanide);molybdenum(2+) has a molecular weight of 296.31 g/mol, XLogP of 4.35, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(di(propan-2-yl)azanide);molybdenum(2+) is sourced from PubChem (CID 141200548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).