About tris(diethylazanide);di(propan-2-yl)azanide;titanium(4+)
tris(diethylazanide);di(propan-2-yl)azanide;titanium(4+) (PubChem CID 87312949) has the molecular formula C18H44N4Ti
and a molecular weight of 364.45 g/mol. Its IUPAC name is tris(diethylazanide);di(propan-2-yl)azanide;titanium(4+).
Molecular Properties
| Compound Name | tris(diethylazanide);di(propan-2-yl)azanide;titanium(4+) |
| PubChem CID | 87312949 |
| Molecular Formula | C18H44N4Ti |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | tris(diethylazanide);di(propan-2-yl)azanide;titanium(4+) |
| SMILES | CC(C)[N-]C(C)C.CC[N-]CC.CC[N-]CC.CC[N-]CC.[Ti+4] |
| InChI | InChI=1S/C6H14N.3C4H10N.Ti/c1-5(2)7-6(3)4;3*1-3-5-4-2;/h5-6H,1-4H3;3*3-4H2,1-2H3;/q4*-1;+4 |
| InChIKey | LVLWTUCLSIXQNR-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 56.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tris(diethylazanide);di(propan-2-yl)azanide;titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(diethylazanide);di(propan-2-yl)azanide;titanium(4+)?
The IUPAC name of tris(diethylazanide);di(propan-2-yl)azanide;titanium(4+) (CID 87312949) is tris(diethylazanide);di(propan-2-yl)azanide;titanium(4+).
What is the SMILES notation for tris(diethylazanide);di(propan-2-yl)azanide;titanium(4+)?
The canonical SMILES for tris(diethylazanide);di(propan-2-yl)azanide;titanium(4+) is CC(C)[N-]C(C)C.CC[N-]CC.CC[N-]CC.CC[N-]CC.[Ti+4].
What is the InChIKey of tris(diethylazanide);di(propan-2-yl)azanide;titanium(4+)?
The InChIKey is LVLWTUCLSIXQNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N.3C4H10N.Ti/c1-5(2)7-6(3)4;3*1-3-5-4-2;/h5-6H,1-4H3;3*3-4H2,1-2H3;/q4*-1;+4.
What are the key properties of tris(diethylazanide);di(propan-2-yl)azanide;titanium(4+)?
tris(diethylazanide);di(propan-2-yl)azanide;titanium(4+) has a molecular weight of 364.45 g/mol, XLogP of 6.37, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tris(diethylazanide);di(propan-2-yl)azanide;titanium(4+) is sourced from PubChem (CID 87312949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).