About diethylazanide;di(propan-2-yl)alumanylium
diethylazanide;di(propan-2-yl)alumanylium (PubChem CID 19362594) has the molecular formula C10H24AlN
and a molecular weight of 185.29 g/mol. Its IUPAC name is diethylazanide;di(propan-2-yl)alumanylium.
Molecular Properties
| Compound Name | diethylazanide;di(propan-2-yl)alumanylium |
| PubChem CID | 19362594 |
| Molecular Formula | C10H24AlN |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.17 |
| IUPAC Name | diethylazanide;di(propan-2-yl)alumanylium |
| SMILES | CC(C)[Al+]C(C)C.CC[N-]CC |
| InChI | InChI=1S/C4H10N.2C3H7.Al/c1-3-5-4-2;2*1-3-2;/h3-4H2,1-2H3;2*3H,1-2H3;/q-1;;;+1 |
| InChIKey | BPNXIRKNLAUWLF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze diethylazanide;di(propan-2-yl)alumanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylazanide;di(propan-2-yl)alumanylium?
The IUPAC name of diethylazanide;di(propan-2-yl)alumanylium (CID 19362594) is diethylazanide;di(propan-2-yl)alumanylium.
What is the SMILES notation for diethylazanide;di(propan-2-yl)alumanylium?
The canonical SMILES for diethylazanide;di(propan-2-yl)alumanylium is CC(C)[Al+]C(C)C.CC[N-]CC.
What is the InChIKey of diethylazanide;di(propan-2-yl)alumanylium?
The InChIKey is BPNXIRKNLAUWLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N.2C3H7.Al/c1-3-5-4-2;2*1-3-2;/h3-4H2,1-2H3;2*3H,1-2H3;/q-1;;;+1.
What are the key properties of diethylazanide;di(propan-2-yl)alumanylium?
diethylazanide;di(propan-2-yl)alumanylium has a molecular weight of 185.29 g/mol, XLogP of 3.75, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diethylazanide;di(propan-2-yl)alumanylium is sourced from PubChem (CID 19362594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).