About carbanide;[[di(propan-2-yl)amino]-propan-2-ylazanidylmethyl]-propan-2-ylazanide;iridium
carbanide;[[di(propan-2-yl)amino]-propan-2-ylazanidylmethyl]-propan-2-ylazanide;iridium (PubChem CID 135011154) has the molecular formula C15H35IrN3-4
and a molecular weight of 449.68 g/mol. Its IUPAC name is carbanide;[[di(propan-2-yl)amino]-propan-2-ylazanidylmethyl]-propan-2-ylazanide;iridium.
Molecular Properties
| Compound Name | carbanide;[[di(propan-2-yl)amino]-propan-2-ylazanidylmethyl]-propan-2-ylazanide;iridium |
| PubChem CID | 135011154 |
| Molecular Formula | C15H35IrN3-4 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | carbanide;[[di(propan-2-yl)amino]-propan-2-ylazanidylmethyl]-propan-2-ylazanide;iridium |
| SMILES | CC(C)[N-]C([N-]C(C)C)N(C(C)C)C(C)C.[CH3-].[CH3-].[Ir] |
| InChI | InChI=1S/C13H29N3.2CH3.Ir/c1-9(2)14-13(15-10(3)4)16(11(5)6)12(7)8;;;/h9-13H,1-8H3;2*1H3;/q-2;2*-1; |
| InChIKey | XKTHLJDNVPIMQB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 31.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;[[di(propan-2-yl)amino]-propan-2-ylazanidylmethyl]-propan-2-ylazanide;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;[[di(propan-2-yl)amino]-propan-2-ylazanidylmethyl]-propan-2-ylazanide;iridium?
The IUPAC name of carbanide;[[di(propan-2-yl)amino]-propan-2-ylazanidylmethyl]-propan-2-ylazanide;iridium (CID 135011154) is carbanide;[[di(propan-2-yl)amino]-propan-2-ylazanidylmethyl]-propan-2-ylazanide;iridium.
What is the SMILES notation for carbanide;[[di(propan-2-yl)amino]-propan-2-ylazanidylmethyl]-propan-2-ylazanide;iridium?
The canonical SMILES for carbanide;[[di(propan-2-yl)amino]-propan-2-ylazanidylmethyl]-propan-2-ylazanide;iridium is CC(C)[N-]C([N-]C(C)C)N(C(C)C)C(C)C.[CH3-].[CH3-].[Ir].
What is the InChIKey of carbanide;[[di(propan-2-yl)amino]-propan-2-ylazanidylmethyl]-propan-2-ylazanide;iridium?
The InChIKey is XKTHLJDNVPIMQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N3.2CH3.Ir/c1-9(2)14-13(15-10(3)4)16(11(5)6)12(7)8;;;/h9-13H,1-8H3;2*1H3;/q-2;2*-1;.
What are the key properties of carbanide;[[di(propan-2-yl)amino]-propan-2-ylazanidylmethyl]-propan-2-ylazanide;iridium?
carbanide;[[di(propan-2-yl)amino]-propan-2-ylazanidylmethyl]-propan-2-ylazanide;iridium has a molecular weight of 449.68 g/mol, XLogP of 4.85, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;[[di(propan-2-yl)amino]-propan-2-ylazanidylmethyl]-propan-2-ylazanide;iridium is sourced from PubChem (CID 135011154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).