About N,N-di(propan-2-yl)propan-2-amine;hydrate
N,N-di(propan-2-yl)propan-2-amine;hydrate (PubChem CID 173081552) has the molecular formula C9H23NO
and a molecular weight of 161.29 g/mol. Its IUPAC name is N,N-di(propan-2-yl)propan-2-amine;hydrate.
Molecular Properties
| Compound Name | N,N-di(propan-2-yl)propan-2-amine;hydrate |
| PubChem CID | 173081552 |
| Molecular Formula | C9H23NO |
| Molecular Weight | 161.29 g/mol |
| Exact Mass | 161.18 |
| IUPAC Name | N,N-di(propan-2-yl)propan-2-amine;hydrate |
| SMILES | CC(C)N(C(C)C)C(C)C.O |
| InChI | InChI=1S/C9H21N.H2O/c1-7(2)10(8(3)4)9(5)6;/h7-9H,1-6H3;1H2 |
| InChIKey | ABPAGCXCCHJBAC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-di(propan-2-yl)propan-2-amine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-di(propan-2-yl)propan-2-amine;hydrate?
The IUPAC name of N,N-di(propan-2-yl)propan-2-amine;hydrate (CID 173081552) is N,N-di(propan-2-yl)propan-2-amine;hydrate.
What is the SMILES notation for N,N-di(propan-2-yl)propan-2-amine;hydrate?
The canonical SMILES for N,N-di(propan-2-yl)propan-2-amine;hydrate is CC(C)N(C(C)C)C(C)C.O.
What is the InChIKey of N,N-di(propan-2-yl)propan-2-amine;hydrate?
The InChIKey is ABPAGCXCCHJBAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N.H2O/c1-7(2)10(8(3)4)9(5)6;/h7-9H,1-6H3;1H2.
What are the key properties of N,N-di(propan-2-yl)propan-2-amine;hydrate?
N,N-di(propan-2-yl)propan-2-amine;hydrate has a molecular weight of 161.29 g/mol, XLogP of 1.69, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-di(propan-2-yl)propan-2-amine;hydrate is sourced from PubChem (CID 173081552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).