C15H36N2 — CID 123192010
N,N-di(propan-2-yl)propan-2-amine;N-methylmethanimine;2-methylpropane (PubChem CID 123192010) has the molecular formula C15H36N2 and a molecular weight of 244.47 g/mol. Its IUPAC name is N,N-di(propan-2-yl)propan-2-amine;N-methylmethanimine;2-methylpropane.
| Compound Name | N,N-di(propan-2-yl)propan-2-amine;N-methylmethanimine;2-methylpropane |
|---|---|
| PubChem CID | 123192010 |
| Molecular Formula | C15H36N2 |
| Molecular Weight | 244.47 g/mol |
| Exact Mass | 244.29 |
| IUPAC Name | N,N-di(propan-2-yl)propan-2-amine;N-methylmethanimine;2-methylpropane |
| SMILES | C=NC.CC(C)C.CC(C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C9H21N.C4H10.C2H5N/c1-7(2)10(8(3)4)9(5)6;1-4(2)3;1-3-2/h7-9H,1-6H3;4H,1-3H3;1H2,2H3 |
| InChIKey | JGUDOJSMDGYOJY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|