C9H19N — CID 171846694
N,N-bis(ethenyl)propan-2-amine;ethane (PubChem CID 171846694) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is N,N-bis(ethenyl)propan-2-amine;ethane.
| Compound Name | N,N-bis(ethenyl)propan-2-amine;ethane |
|---|---|
| PubChem CID | 171846694 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | N,N-bis(ethenyl)propan-2-amine;ethane |
| SMILES | C=CN(C=C)C(C)C.CC |
| InChI | InChI=1S/C7H13N.C2H6/c1-5-8(6-2)7(3)4;1-2/h5-7H,1-2H2,3-4H3;1-2H3 |
| InChIKey | ASDFWTBGCDOIOT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |