About carbanide;propan-2-yl(1-propan-2-ylazanidylethyl)azanide;zirconium
carbanide;propan-2-yl(1-propan-2-ylazanidylethyl)azanide;zirconium (PubChem CID 58635676) has the molecular formula C11H27N2Zr-5
and a molecular weight of 278.58 g/mol. Its IUPAC name is carbanide;propan-2-yl(1-propan-2-ylazanidylethyl)azanide;zirconium.
Molecular Properties
| Compound Name | carbanide;propan-2-yl(1-propan-2-ylazanidylethyl)azanide;zirconium |
| PubChem CID | 58635676 |
| Molecular Formula | C11H27N2Zr-5 |
| Molecular Weight | 278.58 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | carbanide;propan-2-yl(1-propan-2-ylazanidylethyl)azanide;zirconium |
| SMILES | CC(C)[N-]C(C)[N-]C(C)C.[CH3-].[CH3-].[CH3-].[Zr] |
| InChI | InChI=1S/C8H18N2.3CH3.Zr/c1-6(2)9-8(5)10-7(3)4;;;;/h6-8H,1-5H3;3*1H3;/q-2;3*-1; |
| InChIKey | YDOPCAAFLPHHTQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;propan-2-yl(1-propan-2-ylazanidylethyl)azanide;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;propan-2-yl(1-propan-2-ylazanidylethyl)azanide;zirconium?
The IUPAC name of carbanide;propan-2-yl(1-propan-2-ylazanidylethyl)azanide;zirconium (CID 58635676) is carbanide;propan-2-yl(1-propan-2-ylazanidylethyl)azanide;zirconium.
What is the SMILES notation for carbanide;propan-2-yl(1-propan-2-ylazanidylethyl)azanide;zirconium?
The canonical SMILES for carbanide;propan-2-yl(1-propan-2-ylazanidylethyl)azanide;zirconium is CC(C)[N-]C(C)[N-]C(C)C.[CH3-].[CH3-].[CH3-].[Zr].
What is the InChIKey of carbanide;propan-2-yl(1-propan-2-ylazanidylethyl)azanide;zirconium?
The InChIKey is YDOPCAAFLPHHTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2.3CH3.Zr/c1-6(2)9-8(5)10-7(3)4;;;;/h6-8H,1-5H3;3*1H3;/q-2;3*-1;.
What are the key properties of carbanide;propan-2-yl(1-propan-2-ylazanidylethyl)azanide;zirconium?
carbanide;propan-2-yl(1-propan-2-ylazanidylethyl)azanide;zirconium has a molecular weight of 278.58 g/mol, XLogP of 4.24, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;propan-2-yl(1-propan-2-ylazanidylethyl)azanide;zirconium is sourced from PubChem (CID 58635676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).