About di(propan-2-yl)azanide;titanium(3+);dichloride
di(propan-2-yl)azanide;titanium(3+);dichloride (PubChem CID 160772025) has the molecular formula C6H14Cl2NTi
and a molecular weight of 218.96 g/mol. Its IUPAC name is di(propan-2-yl)azanide;titanium(3+);dichloride.
Molecular Properties
| Compound Name | di(propan-2-yl)azanide;titanium(3+);dichloride |
| PubChem CID | 160772025 |
| Molecular Formula | C6H14Cl2NTi |
| Molecular Weight | 218.96 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | di(propan-2-yl)azanide;titanium(3+);dichloride |
| SMILES | CC(C)[N-]C(C)C.[Cl-].[Cl-].[Ti+3] |
| InChI | InChI=1S/C6H14N.2ClH.Ti/c1-5(2)7-6(3)4;;;/h5-6H,1-4H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | RZLDWINFVXIBMT-UHFFFAOYSA-L |
| XLogP | -3.82 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.96 |
| LogP ≤ 5 | -3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze di(propan-2-yl)azanide;titanium(3+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(propan-2-yl)azanide;titanium(3+);dichloride?
The IUPAC name of di(propan-2-yl)azanide;titanium(3+);dichloride (CID 160772025) is di(propan-2-yl)azanide;titanium(3+);dichloride.
What is the SMILES notation for di(propan-2-yl)azanide;titanium(3+);dichloride?
The canonical SMILES for di(propan-2-yl)azanide;titanium(3+);dichloride is CC(C)[N-]C(C)C.[Cl-].[Cl-].[Ti+3].
What is the InChIKey of di(propan-2-yl)azanide;titanium(3+);dichloride?
The InChIKey is RZLDWINFVXIBMT-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H14N.2ClH.Ti/c1-5(2)7-6(3)4;;;/h5-6H,1-4H3;2*1H;/q-1;;;+3/p-2.
What are the key properties of di(propan-2-yl)azanide;titanium(3+);dichloride?
di(propan-2-yl)azanide;titanium(3+);dichloride has a molecular weight of 218.96 g/mol, XLogP of -3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for di(propan-2-yl)azanide;titanium(3+);dichloride is sourced from PubChem (CID 160772025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).