About butan-2-yl(1-propan-2-ylazanidylethyl)azanide;carbanide;yttrium
butan-2-yl(1-propan-2-ylazanidylethyl)azanide;carbanide;yttrium (PubChem CID 167346325) has the molecular formula C11H26N2Y-4
and a molecular weight of 275.25 g/mol. Its IUPAC name is butan-2-yl(1-propan-2-ylazanidylethyl)azanide;carbanide;yttrium.
Molecular Properties
| Compound Name | butan-2-yl(1-propan-2-ylazanidylethyl)azanide;carbanide;yttrium |
| PubChem CID | 167346325 |
| Molecular Formula | C11H26N2Y-4 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | butan-2-yl(1-propan-2-ylazanidylethyl)azanide;carbanide;yttrium |
| SMILES | CCC(C)[N-]C(C)[N-]C(C)C.[CH3-].[CH3-].[Y] |
| InChI | InChI=1S/C9H20N2.2CH3.Y/c1-6-8(4)11-9(5)10-7(2)3;;;/h7-9H,6H2,1-5H3;2*1H3;/q-2;2*-1; |
| InChIKey | MZSGYDATOXQPMC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yl(1-propan-2-ylazanidylethyl)azanide;carbanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl(1-propan-2-ylazanidylethyl)azanide;carbanide;yttrium?
The IUPAC name of butan-2-yl(1-propan-2-ylazanidylethyl)azanide;carbanide;yttrium (CID 167346325) is butan-2-yl(1-propan-2-ylazanidylethyl)azanide;carbanide;yttrium.
What is the SMILES notation for butan-2-yl(1-propan-2-ylazanidylethyl)azanide;carbanide;yttrium?
The canonical SMILES for butan-2-yl(1-propan-2-ylazanidylethyl)azanide;carbanide;yttrium is CCC(C)[N-]C(C)[N-]C(C)C.[CH3-].[CH3-].[Y].
What is the InChIKey of butan-2-yl(1-propan-2-ylazanidylethyl)azanide;carbanide;yttrium?
The InChIKey is MZSGYDATOXQPMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2.2CH3.Y/c1-6-8(4)11-9(5)10-7(2)3;;;/h7-9H,6H2,1-5H3;2*1H3;/q-2;2*-1;.
What are the key properties of butan-2-yl(1-propan-2-ylazanidylethyl)azanide;carbanide;yttrium?
butan-2-yl(1-propan-2-ylazanidylethyl)azanide;carbanide;yttrium has a molecular weight of 275.25 g/mol, XLogP of 4.18, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl(1-propan-2-ylazanidylethyl)azanide;carbanide;yttrium is sourced from PubChem (CID 167346325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).