About butan-2-yl(4-butan-2-ylazanidylpentan-2-yl)azanide;carbanide;zinc
butan-2-yl(4-butan-2-ylazanidylpentan-2-yl)azanide;carbanide;zinc (PubChem CID 168728760) has the molecular formula C14H31N2Zn-3
and a molecular weight of 292.81 g/mol. Its IUPAC name is butan-2-yl(4-butan-2-ylazanidylpentan-2-yl)azanide;carbanide;zinc.
Molecular Properties
| Compound Name | butan-2-yl(4-butan-2-ylazanidylpentan-2-yl)azanide;carbanide;zinc |
| PubChem CID | 168728760 |
| Molecular Formula | C14H31N2Zn-3 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | butan-2-yl(4-butan-2-ylazanidylpentan-2-yl)azanide;carbanide;zinc |
| SMILES | CCC(C)[N-]C(C)CC(C)[N-]C(C)CC.[CH3-].[Zn] |
| InChI | InChI=1S/C13H28N2.CH3.Zn/c1-7-10(3)14-12(5)9-13(6)15-11(4)8-2;;/h10-13H,7-9H2,1-6H3;1H3;/q-2;-1; |
| InChIKey | WTRDGEWWYZOSOS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yl(4-butan-2-ylazanidylpentan-2-yl)azanide;carbanide;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl(4-butan-2-ylazanidylpentan-2-yl)azanide;carbanide;zinc?
The IUPAC name of butan-2-yl(4-butan-2-ylazanidylpentan-2-yl)azanide;carbanide;zinc (CID 168728760) is butan-2-yl(4-butan-2-ylazanidylpentan-2-yl)azanide;carbanide;zinc.
What is the SMILES notation for butan-2-yl(4-butan-2-ylazanidylpentan-2-yl)azanide;carbanide;zinc?
The canonical SMILES for butan-2-yl(4-butan-2-ylazanidylpentan-2-yl)azanide;carbanide;zinc is CCC(C)[N-]C(C)CC(C)[N-]C(C)CC.[CH3-].[Zn].
What is the InChIKey of butan-2-yl(4-butan-2-ylazanidylpentan-2-yl)azanide;carbanide;zinc?
The InChIKey is WTRDGEWWYZOSOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2.CH3.Zn/c1-7-10(3)14-12(5)9-13(6)15-11(4)8-2;;/h10-13H,7-9H2,1-6H3;1H3;/q-2;-1;.
What are the key properties of butan-2-yl(4-butan-2-ylazanidylpentan-2-yl)azanide;carbanide;zinc?
butan-2-yl(4-butan-2-ylazanidylpentan-2-yl)azanide;carbanide;zinc has a molecular weight of 292.81 g/mol, XLogP of 4.95, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl(4-butan-2-ylazanidylpentan-2-yl)azanide;carbanide;zinc is sourced from PubChem (CID 168728760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).