About ethane;methyl(4-methylazanidylpentan-2-yl)azanide;zinc
ethane;methyl(4-methylazanidylpentan-2-yl)azanide;zinc (PubChem CID 168728778) has the molecular formula C9H21N2Zn-3
and a molecular weight of 222.67 g/mol. Its IUPAC name is ethane;methyl(4-methylazanidylpentan-2-yl)azanide;zinc.
Molecular Properties
| Compound Name | ethane;methyl(4-methylazanidylpentan-2-yl)azanide;zinc |
| PubChem CID | 168728778 |
| Molecular Formula | C9H21N2Zn-3 |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | ethane;methyl(4-methylazanidylpentan-2-yl)azanide;zinc |
| SMILES | C[N-]C(C)CC(C)[N-]C.[CH2-]C.[Zn] |
| InChI | InChI=1S/C7H16N2.C2H5.Zn/c1-6(8-3)5-7(2)9-4;1-2;/h6-7H,5H2,1-4H3;1H2,2H3;/q-2;-1; |
| InChIKey | XWWWLGDZTHBBAR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl(4-methylazanidylpentan-2-yl)azanide;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl(4-methylazanidylpentan-2-yl)azanide;zinc?
The IUPAC name of ethane;methyl(4-methylazanidylpentan-2-yl)azanide;zinc (CID 168728778) is ethane;methyl(4-methylazanidylpentan-2-yl)azanide;zinc.
What is the SMILES notation for ethane;methyl(4-methylazanidylpentan-2-yl)azanide;zinc?
The canonical SMILES for ethane;methyl(4-methylazanidylpentan-2-yl)azanide;zinc is C[N-]C(C)CC(C)[N-]C.[CH2-]C.[Zn].
What is the InChIKey of ethane;methyl(4-methylazanidylpentan-2-yl)azanide;zinc?
The InChIKey is XWWWLGDZTHBBAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2.C2H5.Zn/c1-6(8-3)5-7(2)9-4;1-2;/h6-7H,5H2,1-4H3;1H2,2H3;/q-2;-1;.
What are the key properties of ethane;methyl(4-methylazanidylpentan-2-yl)azanide;zinc?
ethane;methyl(4-methylazanidylpentan-2-yl)azanide;zinc has a molecular weight of 222.67 g/mol, XLogP of 3.00, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl(4-methylazanidylpentan-2-yl)azanide;zinc is sourced from PubChem (CID 168728778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).