C15H30F3N2Zn-3 — CID 168728711
butan-2-yl-(4-butan-2-ylazanidyl-1,1,1-trifluoropentan-2-yl)azanide;ethane;zinc (PubChem CID 168728711) has the molecular formula C15H30F3N2Zn-3 and a molecular weight of 360.80 g/mol. Its IUPAC name is butan-2-yl-(4-butan-2-ylazanidyl-1,1,1-trifluoropentan-2-yl)azanide;ethane;zinc.
| Compound Name | butan-2-yl-(4-butan-2-ylazanidyl-1,1,1-trifluoropentan-2-yl)azanide;ethane;zinc |
|---|---|
| PubChem CID | 168728711 |
| Molecular Formula | C15H30F3N2Zn-3 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | butan-2-yl-(4-butan-2-ylazanidyl-1,1,1-trifluoropentan-2-yl)azanide;ethane;zinc |
| SMILES | CCC(C)[N-]C(C)CC([N-]C(C)CC)C(F)(F)F.[CH2-]C.[Zn] |
| InChI | InChI=1S/C13H25F3N2.C2H5.Zn/c1-6-9(3)17-11(5)8-12(13(14,15)16)18-10(4)7-2;1-2;/h9-12H,6-8H2,1-5H3;1H2,2H3;/q-2;-1; |
| InChIKey | SSJFRJPBGIMEMK-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|