About bis(methyl(4-methylazanidylpentan-2-yl)azanide);zinc
bis(methyl(4-methylazanidylpentan-2-yl)azanide);zinc (PubChem CID 166057289) has the molecular formula C14H32N4Zn-4
and a molecular weight of 321.83 g/mol. Its IUPAC name is bis(methyl(4-methylazanidylpentan-2-yl)azanide);zinc.
Molecular Properties
| Compound Name | bis(methyl(4-methylazanidylpentan-2-yl)azanide);zinc |
| PubChem CID | 166057289 |
| Molecular Formula | C14H32N4Zn-4 |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | bis(methyl(4-methylazanidylpentan-2-yl)azanide);zinc |
| SMILES | C[N-]C(C)CC(C)[N-]C.C[N-]C(C)CC(C)[N-]C.[Zn] |
| InChI | InChI=1S/2C7H16N2.Zn/c2*1-6(8-3)5-7(2)9-4;/h2*6-7H,5H2,1-4H3;/q2*-2; |
| InChIKey | HBOQSHZETBVVOH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 56.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(methyl(4-methylazanidylpentan-2-yl)azanide);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(methyl(4-methylazanidylpentan-2-yl)azanide);zinc?
The IUPAC name of bis(methyl(4-methylazanidylpentan-2-yl)azanide);zinc (CID 166057289) is bis(methyl(4-methylazanidylpentan-2-yl)azanide);zinc.
What is the SMILES notation for bis(methyl(4-methylazanidylpentan-2-yl)azanide);zinc?
The canonical SMILES for bis(methyl(4-methylazanidylpentan-2-yl)azanide);zinc is C[N-]C(C)CC(C)[N-]C.C[N-]C(C)CC(C)[N-]C.[Zn].
What is the InChIKey of bis(methyl(4-methylazanidylpentan-2-yl)azanide);zinc?
The InChIKey is HBOQSHZETBVVOH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H16N2.Zn/c2*1-6(8-3)5-7(2)9-4;/h2*6-7H,5H2,1-4H3;/q2*-2;.
What are the key properties of bis(methyl(4-methylazanidylpentan-2-yl)azanide);zinc?
bis(methyl(4-methylazanidylpentan-2-yl)azanide);zinc has a molecular weight of 321.83 g/mol, XLogP of 4.32, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(methyl(4-methylazanidylpentan-2-yl)azanide);zinc is sourced from PubChem (CID 166057289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).