C24H44NO4- — CID 163116873
methyl-[(2S,4E,6E,8S,10S,12S,14S)-8,10,12,14-tetramethoxy-5,7-dimethylheptadeca-4,6,16-trien-2-yl]azanide (PubChem CID 163116873) has the molecular formula C24H44NO4- and a molecular weight of 410.62 g/mol. Its IUPAC name is methyl-[(2S,4E,6E,8S,10S,12S,14S)-8,10,12,14-tetramethoxy-5,7-dimethylheptadeca-4,6,16-trien-2-yl]azanide.
| Compound Name | methyl-[(2S,4E,6E,8S,10S,12S,14S)-8,10,12,14-tetramethoxy-5,7-dimethylheptadeca-4,6,16-trien-2-yl]azanide |
|---|---|
| PubChem CID | 163116873 |
| Molecular Formula | C24H44NO4- |
| Molecular Weight | 410.62 g/mol |
| Exact Mass | 410.33 |
| IUPAC Name | methyl-[(2S,4E,6E,8S,10S,12S,14S)-8,10,12,14-tetramethoxy-5,7-dimethylheptadeca-4,6,16-trien-2-yl]azanide |
| SMILES | C=CC[C@@H](C[C@@H](C[C@@H](C[C@H](OC)/C(C)=C/C(C)=C/C[C@H](C)[N-]C)OC)OC)OC |
| InChI | InChI=1S/C24H44NO4/c1-10-11-21(26-6)15-22(27-7)16-23(28-8)17-24(29-9)19(3)14-18(2)12-13-20(4)25-5/h10,12,14,20-24H,1,11,13,15-17H2,2-9H3/q-1/b18-12+,19-14+/t20-,21-,22-,23-,24-/m0/s1 |
| InChIKey | IZYIYYRFZDIQFT-GAAPUSCWSA-N |
| XLogP | 5.47 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|