C24H43NO4 — CID 163141413
methanidyl-[(2E,4E,6E,8S,10S,12S,14S)-8,10,12,14-tetramethoxy-5,7-dimethylheptadeca-2,4,6,16-tetraen-2-yl]azanium (PubChem CID 163141413) has the molecular formula C24H43NO4 and a molecular weight of 409.61 g/mol. Its IUPAC name is methanidyl-[(2E,4E,6E,8S,10S,12S,14S)-8,10,12,14-tetramethoxy-5,7-dimethylheptadeca-2,4,6,16-tetraen-2-yl]azanium.
| Compound Name | methanidyl-[(2E,4E,6E,8S,10S,12S,14S)-8,10,12,14-tetramethoxy-5,7-dimethylheptadeca-2,4,6,16-tetraen-2-yl]azanium |
|---|---|
| PubChem CID | 163141413 |
| Molecular Formula | C24H43NO4 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.32 |
| IUPAC Name | methanidyl-[(2E,4E,6E,8S,10S,12S,14S)-8,10,12,14-tetramethoxy-5,7-dimethylheptadeca-2,4,6,16-tetraen-2-yl]azanium |
| SMILES | C=CC[C@@H](C[C@@H](C[C@@H](C[C@H](OC)/C(C)=C/C(C)=C/C=C(\C)[NH2+][CH2-])OC)OC)OC |
| InChI | InChI=1S/C24H43NO4/c1-10-11-21(26-6)15-22(27-7)16-23(28-8)17-24(29-9)19(3)14-18(2)12-13-20(4)25-5/h10,12-14,21-24H,1,5,11,15-17,25H2,2-4,6-9H3/b18-12+,19-14+,20-13+/t21-,22-,23-,24-/m0/s1 |
| InChIKey | JXDGYTOTBPEEPQ-MRHINEGBSA-N |
| XLogP | 3.94 |
| TPSA | 53.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|