C31H60O7 — CID 73090780
4,6,8,10,12,14,16-heptamethoxy-17-methyltricosa-1,17-diene (PubChem CID 73090780) has the molecular formula C31H60O7 and a molecular weight of 544.81 g/mol. Its IUPAC name is 4,6,8,10,12,14,16-heptamethoxy-17-methyltricosa-1,17-diene.
| Compound Name | 4,6,8,10,12,14,16-heptamethoxy-17-methyltricosa-1,17-diene |
|---|---|
| PubChem CID | 73090780 |
| Molecular Formula | C31H60O7 |
| Molecular Weight | 544.81 g/mol |
| Exact Mass | 544.43 |
| IUPAC Name | 4,6,8,10,12,14,16-heptamethoxy-17-methyltricosa-1,17-diene |
| SMILES | C=CCC(CC(CC(CC(CC(CC(CC(OC)C(C)=CCCCCC)OC)OC)OC)OC)OC)OC |
| InChI | InChI=1S/C31H60O7/c1-11-13-14-15-17-24(3)31(38-10)23-30(37-9)22-29(36-8)21-28(35-7)20-27(34-6)19-26(33-5)18-25(32-4)16-12-2/h12,17,25-31H,2,11,13-16,18-23H2,1,3-10H3 |
| InChIKey | BHBZIDHROZIXAX-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.81 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|