About 7,8-dimethyltridec-6-ene
7,8-dimethyltridec-6-ene (PubChem CID 123214902) has the molecular formula C15H30
and a molecular weight of 210.40 g/mol. Its IUPAC name is 7,8-dimethyltridec-6-ene.
Molecular Properties
| Compound Name | 7,8-dimethyltridec-6-ene |
| PubChem CID | 123214902 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | 7,8-dimethyltridec-6-ene |
| SMILES | CCCCCC=C(C)C(C)CCCCC |
| InChI | InChI=1S/C15H30/c1-5-7-9-11-13-15(4)14(3)12-10-8-6-2/h13-14H,5-12H2,1-4H3 |
| InChIKey | PEDDUXBMPAIHHX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7,8-dimethyltridec-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethyltridec-6-ene?
The IUPAC name of 7,8-dimethyltridec-6-ene (CID 123214902) is 7,8-dimethyltridec-6-ene.
What is the SMILES notation for 7,8-dimethyltridec-6-ene?
The canonical SMILES for 7,8-dimethyltridec-6-ene is CCCCCC=C(C)C(C)CCCCC.
What is the InChIKey of 7,8-dimethyltridec-6-ene?
The InChIKey is PEDDUXBMPAIHHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30/c1-5-7-9-11-13-15(4)14(3)12-10-8-6-2/h13-14H,5-12H2,1-4H3.
What are the key properties of 7,8-dimethyltridec-6-ene?
7,8-dimethyltridec-6-ene has a molecular weight of 210.40 g/mol, XLogP of 5.73, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethyltridec-6-ene is sourced from PubChem (CID 123214902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).