C26H52O7 — CID 46844562
(4S,6R,8R,10R,12R,14R)-6,8,10,12,14-pentamethoxy-4-(methoxymethoxy)nonadec-1-ene (PubChem CID 46844562) has the molecular formula C26H52O7 and a molecular weight of 476.70 g/mol. Its IUPAC name is (4S,6R,8R,10R,12R,14R)-6,8,10,12,14-pentamethoxy-4-(methoxymethoxy)nonadec-1-ene.
| Compound Name | (4S,6R,8R,10R,12R,14R)-6,8,10,12,14-pentamethoxy-4-(methoxymethoxy)nonadec-1-ene |
|---|---|
| PubChem CID | 46844562 |
| Molecular Formula | C26H52O7 |
| Molecular Weight | 476.70 g/mol |
| Exact Mass | 476.37 |
| IUPAC Name | (4S,6R,8R,10R,12R,14R)-6,8,10,12,14-pentamethoxy-4-(methoxymethoxy)nonadec-1-ene |
| SMILES | C=CC[C@@H](C[C@@H](C[C@@H](C[C@@H](C[C@@H](C[C@@H](CCCCC)OC)OC)OC)OC)OC)OCOC |
| InChI | InChI=1S/C26H52O7/c1-9-11-12-14-21(28-4)15-23(29-5)17-25(31-7)19-26(32-8)18-24(30-6)16-22(13-10-2)33-20-27-3/h10,21-26H,2,9,11-20H2,1,3-8H3/t21-,22+,23-,24+,25-,26+/m1/s1 |
| InChIKey | HNBVOSAORJZJEO-RMPBONJYSA-N |
| XLogP | 5.16 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.70 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|