C27H54O3Si2 — CID 72723811
triethyl-[(3E,6R,8S,10S)-8-methoxy-6-methyl-10-triethylsilyloxytrideca-1,3,12-trien-2-yl]oxysilane (PubChem CID 72723811) has the molecular formula C27H54O3Si2 and a molecular weight of 482.90 g/mol. Its IUPAC name is triethyl-[(3E,6R,8S,10S)-8-methoxy-6-methyl-10-triethylsilyloxytrideca-1,3,12-trien-2-yl]oxysilane.
| Compound Name | triethyl-[(3E,6R,8S,10S)-8-methoxy-6-methyl-10-triethylsilyloxytrideca-1,3,12-trien-2-yl]oxysilane |
|---|---|
| PubChem CID | 72723811 |
| Molecular Formula | C27H54O3Si2 |
| Molecular Weight | 482.90 g/mol |
| Exact Mass | 482.36 |
| IUPAC Name | triethyl-[(3E,6R,8S,10S)-8-methoxy-6-methyl-10-triethylsilyloxytrideca-1,3,12-trien-2-yl]oxysilane |
| SMILES | C=CC[C@@H](C[C@H](C[C@H](C)C/C=C/C(=C)O[Si](CC)(CC)CC)OC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C27H54O3Si2/c1-11-19-26(30-32(15-5,16-6)17-7)23-27(28-10)22-24(8)20-18-21-25(9)29-31(12-2,13-3)14-4/h11,18,21,24,26-27H,1,9,12-17,19-20,22-23H2,2-8,10H3/b21-18+/t24-,26+,27+/m1/s1 |
| InChIKey | XHDUQGHBHYPWRC-WVTWBVGLSA-N |
| XLogP | 8.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.90 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|