C24H39NO4 — CID 153438136
16-isocyano-4,6,8,10-tetramethoxy-3-methyl-11-methylideneheptadeca-1,12,15-triene (PubChem CID 153438136) has the molecular formula C24H39NO4 and a molecular weight of 405.58 g/mol. Its IUPAC name is 16-isocyano-4,6,8,10-tetramethoxy-3-methyl-11-methylideneheptadeca-1,12,15-triene.
| Compound Name | 16-isocyano-4,6,8,10-tetramethoxy-3-methyl-11-methylideneheptadeca-1,12,15-triene |
|---|---|
| PubChem CID | 153438136 |
| Molecular Formula | C24H39NO4 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | 16-isocyano-4,6,8,10-tetramethoxy-3-methyl-11-methylideneheptadeca-1,12,15-triene |
| SMILES | [C-]#[N+]C(C)=CCC=CC(=C)C(CC(CC(CC(OC)C(C)C=C)OC)OC)OC |
| InChI | InChI=1S/C24H39NO4/c1-10-18(2)23(28-8)16-21(26-6)15-22(27-7)17-24(29-9)19(3)13-11-12-14-20(4)25-5/h10-11,13-14,18,21-24H,1,3,12,15-17H2,2,4,6-9H3 |
| InChIKey | XIKSEKRSKNMFQD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 41.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|