C10H18O2 — CID 54202946
5-methoxy-3-methylocta-3,7-dien-2-ol (PubChem CID 54202946) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 5-methoxy-3-methylocta-3,7-dien-2-ol.
| Compound Name | 5-methoxy-3-methylocta-3,7-dien-2-ol |
|---|---|
| PubChem CID | 54202946 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 5-methoxy-3-methylocta-3,7-dien-2-ol |
| SMILES | C=CCC(C=C(C)C(C)O)OC |
| InChI | InChI=1S/C10H18O2/c1-5-6-10(12-4)7-8(2)9(3)11/h5,7,9-11H,1,6H2,2-4H3 |
| InChIKey | PQNIOSMNKVYBAB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|