About 6-methoxyoct-7-en-2-ol
6-methoxyoct-7-en-2-ol (PubChem CID 11550053) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is 6-methoxyoct-7-en-2-ol.
Molecular Properties
| Compound Name | 6-methoxyoct-7-en-2-ol |
| PubChem CID | 11550053 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 6-methoxyoct-7-en-2-ol |
| SMILES | C=CC(CCCC(C)O)OC |
| InChI | InChI=1S/C9H18O2/c1-4-9(11-3)7-5-6-8(2)10/h4,8-10H,1,5-7H2,2-3H3 |
| InChIKey | SRFCBUACGQWULA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxyoct-7-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxyoct-7-en-2-ol?
The IUPAC name of 6-methoxyoct-7-en-2-ol (CID 11550053) is 6-methoxyoct-7-en-2-ol.
What is the SMILES notation for 6-methoxyoct-7-en-2-ol?
The canonical SMILES for 6-methoxyoct-7-en-2-ol is C=CC(CCCC(C)O)OC.
What is the InChIKey of 6-methoxyoct-7-en-2-ol?
The InChIKey is SRFCBUACGQWULA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2/c1-4-9(11-3)7-5-6-8(2)10/h4,8-10H,1,5-7H2,2-3H3.
What are the key properties of 6-methoxyoct-7-en-2-ol?
6-methoxyoct-7-en-2-ol has a molecular weight of 158.24 g/mol, XLogP of 1.74, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxyoct-7-en-2-ol is sourced from PubChem (CID 11550053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).