About propan-2-yliminoalumane
propan-2-yliminoalumane (PubChem CID 173149754) has the molecular formula C3H8AlN
and a molecular weight of 85.09 g/mol. Its IUPAC name is propan-2-yliminoalumane.
Molecular Properties
| Compound Name | propan-2-yliminoalumane |
| PubChem CID | 173149754 |
| Molecular Formula | C3H8AlN |
| Molecular Weight | 85.09 g/mol |
| Exact Mass | 85.05 |
| IUPAC Name | propan-2-yliminoalumane |
| SMILES | [H]/[Al]=N/C(C)C |
| InChI | InChI=1S/C3H7N.Al.H/c1-3(2)4;;/h3H,1-2H3;; |
| InChIKey | AZYAIRKLKNAYDV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.09 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propan-2-yliminoalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yliminoalumane?
The IUPAC name of propan-2-yliminoalumane (CID 173149754) is propan-2-yliminoalumane.
What is the SMILES notation for propan-2-yliminoalumane?
The canonical SMILES for propan-2-yliminoalumane is [H]/[Al]=N/C(C)C.
What is the InChIKey of propan-2-yliminoalumane?
The InChIKey is AZYAIRKLKNAYDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N.Al.H/c1-3(2)4;;/h3H,1-2H3;;.
What are the key properties of propan-2-yliminoalumane?
propan-2-yliminoalumane has a molecular weight of 85.09 g/mol, XLogP of 0.48, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yliminoalumane is sourced from PubChem (CID 173149754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).