C12H16N2 — CID 158127394
N-(2,4-dimethylphenyl)-N'-propan-2-ylmethanediimine (PubChem CID 158127394) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-N'-propan-2-ylmethanediimine.
| Compound Name | N-(2,4-dimethylphenyl)-N'-propan-2-ylmethanediimine |
|---|---|
| PubChem CID | 158127394 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N-(2,4-dimethylphenyl)-N'-propan-2-ylmethanediimine |
| SMILES | Cc1ccc(N=C=NC(C)C)c(C)c1 |
| InChI | InChI=1S/C12H16N2/c1-9(2)13-8-14-12-6-5-10(3)7-11(12)4/h5-7,9H,1-4H3 |
| InChIKey | MLTHTRIAGDDZIZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|