C30H26ClFN2O3 — CID 146235494
benzyl 3-[5-chloro-6-(2-fluorophenyl)-2-(2-propan-2-ylanilino)-3-pyridinyl]-3-oxopropanoate (PubChem CID 146235494) has the molecular formula C30H26ClFN2O3 and a molecular weight of 517.00 g/mol. Its IUPAC name is benzyl 3-[5-chloro-6-(2-fluorophenyl)-2-(2-propan-2-ylanilino)-3-pyridinyl]-3-oxopropanoate.
| Compound Name | benzyl 3-[5-chloro-6-(2-fluorophenyl)-2-(2-propan-2-ylanilino)-3-pyridinyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 146235494 |
| Molecular Formula | C30H26ClFN2O3 |
| Molecular Weight | 517.00 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | benzyl 3-[5-chloro-6-(2-fluorophenyl)-2-(2-propan-2-ylanilino)-3-pyridinyl]-3-oxopropanoate |
| SMILES | CC(C)c1ccccc1Nc1nc(-c2ccccc2F)c(Cl)cc1C(=O)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H26ClFN2O3/c1-19(2)21-12-7-9-15-26(21)33-30-23(16-24(31)29(34-30)22-13-6-8-14-25(22)32)27(35)17-28(36)37-18-20-10-4-3-5-11-20/h3-16,19H,17-18H2,1-2H3,(H,33,34) |
| InChIKey | KDGBLTAGOAEVKK-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.00 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|